C17H14N2O — CID 6166952
(3Z)-3-benzylidene-4,8b-dihydro-3aH-indeno[2,1-c]pyrazol-3-ium-1-olate (PubChem CID 6166952) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is (3Z)-3-benzylidene-4,8b-dihydro-3aH-indeno[2,1-c]pyrazol-3-ium-1-olate.
| Compound Name | (3Z)-3-benzylidene-4,8b-dihydro-3aH-indeno[2,1-c]pyrazol-3-ium-1-olate |
|---|---|
| PubChem CID | 6166952 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (3Z)-3-benzylidene-4,8b-dihydro-3aH-indeno[2,1-c]pyrazol-3-ium-1-olate |
| SMILES | [O-]C1=N/[N+](=C\c2ccccc2)C2Cc3ccccc3C12 |
| InChI | InChI=1S/C17H14N2O/c20-17-16-14-9-5-4-8-13(14)10-15(16)19(18-17)11-12-6-2-1-3-7-12/h1-9,11,15-16H,10H2/b19-11- |
| InChIKey | BYLYVCAOVWAYEM-ODLFYWEKSA-N |
| XLogP | 1.51 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|