C24H18N2O — CID 177410853
(3aS,9bS)-1-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[g]indazol-1-ium-3-olate (PubChem CID 177410853) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is (3aS,9bS)-1-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[g]indazol-1-ium-3-olate.
| Compound Name | (3aS,9bS)-1-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[g]indazol-1-ium-3-olate |
|---|---|
| PubChem CID | 177410853 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (3aS,9bS)-1-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[g]indazol-1-ium-3-olate |
| SMILES | [O-]C1=N[N+](=C2c3ccccc3-c3ccccc32)[C@@H]2c3ccccc3CC[C@H]12 |
| InChI | InChI=1S/C24H18N2O/c27-24-21-14-13-15-7-1-2-8-16(15)22(21)26(25-24)23-19-11-5-3-9-17(19)18-10-4-6-12-20(18)23/h1-12,21-22H,13-14H2/t21-,22+/m0/s1 |
| InChIKey | FDCFVAMDYJZSEX-FCHUYYIVSA-N |
| XLogP | 3.51 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|