C23H24N2O3 — CID 123953058
1-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-2-methyl-2-phenylcyclopropane-1-carboxamide (PubChem CID 123953058) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-2-methyl-2-phenylcyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-2-methyl-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123953058 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-2-methyl-2-phenylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(N2C(=O)c3ccccc3C2=O)CC1(C)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3/c1-4-24(5-2)21(28)23(15-22(23,3)16-11-7-6-8-12-16)25-19(26)17-13-9-10-14-18(17)20(25)27/h6-14H,4-5,15H2,1-3H3 |
| InChIKey | KSOPXOFMUDKDIL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|