C13H24O3 — CID 123954417
3-(2,5-dimethyloxan-3-yl)-2,5-dimethyl-1,4-dioxane (PubChem CID 123954417) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3-(2,5-dimethyloxan-3-yl)-2,5-dimethyl-1,4-dioxane.
| Compound Name | 3-(2,5-dimethyloxan-3-yl)-2,5-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 123954417 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-(2,5-dimethyloxan-3-yl)-2,5-dimethyl-1,4-dioxane |
| SMILES | CC1COC(C)C(C2OC(C)COC2C)C1 |
| InChI | InChI=1S/C13H24O3/c1-8-5-12(10(3)14-6-8)13-11(4)15-7-9(2)16-13/h8-13H,5-7H2,1-4H3 |
| InChIKey | RCPBSXHGNNMIEP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |