C17H15F3N6O2 — CID 123958211
N-methyl-2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydroimidazo[2,1-d][1,5]benzoxazepine-9-carboxamide (PubChem CID 123958211) has the molecular formula C17H15F3N6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-methyl-2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydroimidazo[2,1-d][1,5]benzoxazepine-9-carboxamide.
| Compound Name | N-methyl-2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydroimidazo[2,1-d][1,5]benzoxazepine-9-carboxamide |
|---|---|
| PubChem CID | 123958211 |
| Molecular Formula | C17H15F3N6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-methyl-2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydroimidazo[2,1-d][1,5]benzoxazepine-9-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)-n1cc(-c3ncnn3CC(F)(F)F)nc1CCO2 |
| InChI | InChI=1S/C17H15F3N6O2/c1-21-16(27)10-2-3-13-12(6-10)25-7-11(24-14(25)4-5-28-13)15-22-9-23-26(15)8-17(18,19)20/h2-3,6-7,9H,4-5,8H2,1H3,(H,21,27) |
| InChIKey | NWUPYVPEIJOCBG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |