C13H28N2 — CID 123958518
2-ethyl-N,N,2,4,5-pentamethylhexanimidamide (PubChem CID 123958518) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-ethyl-N,N,2,4,5-pentamethylhexanimidamide.
| Compound Name | 2-ethyl-N,N,2,4,5-pentamethylhexanimidamide |
|---|---|
| PubChem CID | 123958518 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2-ethyl-N,N,2,4,5-pentamethylhexanimidamide |
| SMILES | [H]/N=C(\N(C)C)C(C)(CC)CC(C)C(C)C |
| InChI | InChI=1S/C13H28N2/c1-8-13(5,12(14)15(6)7)9-11(4)10(2)3/h10-11,14H,8-9H2,1-7H3/b14-12- |
| InChIKey | DCASPMDRVUBJPG-OWBHPGMISA-N |
| XLogP | 3.62 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|