About 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate
2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate (PubChem CID 123960034) has the molecular formula C17H30O7
and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate |
| PubChem CID | 123960034 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate |
| SMILES | CC(O)COC(=O)CCC(=O)C(C)(C)OC(C)COC(=O)C(C)C |
| InChI | InChI=1S/C17H30O7/c1-11(2)16(21)23-10-13(4)24-17(5,6)14(19)7-8-15(20)22-9-12(3)18/h11-13,18H,7-10H2,1-6H3 |
| InChIKey | XLJFQWLJXUZVCJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate?
The IUPAC name of 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate (CID 123960034) is 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate.
What is the SMILES notation for 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate?
The canonical SMILES for 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate is CC(O)COC(=O)CCC(=O)C(C)(C)OC(C)COC(=O)C(C)C.
What is the InChIKey of 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate?
The InChIKey is XLJFQWLJXUZVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O7/c1-11(2)16(21)23-10-13(4)24-17(5,6)14(19)7-8-15(20)22-9-12(3)18/h11-13,18H,7-10H2,1-6H3.
What are the key properties of 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate?
2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate has a molecular weight of 346.42 g/mol, XLogP of 1.64, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 5-methyl-5-[1-(2-methylpropanoyloxy)propan-2-yloxy]-4-oxohexanoate is sourced from PubChem (CID 123960034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).