About 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate
1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate (PubChem CID 171580769) has the molecular formula C17H22O9
and a molecular weight of 370.35 g/mol. Its IUPAC name is 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate.
Molecular Properties
| Compound Name | 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate |
| PubChem CID | 171580769 |
| Molecular Formula | C17H22O9 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate |
| SMILES | C#CCOC(=O)/C=C/C(=O)OCC(C)OC(=O)CCC(=O)OCC(C)O |
| InChI | InChI=1S/C17H22O9/c1-4-9-23-14(19)5-6-16(21)25-11-13(3)26-17(22)8-7-15(20)24-10-12(2)18/h1,5-6,12-13,18H,7-11H2,2-3H3/b6-5+ |
| InChIKey | IGJNFCWTAXZZKT-AATRIKPKSA-N |
| XLogP | -0.10 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate?
The IUPAC name of 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate (CID 171580769) is 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate.
What is the SMILES notation for 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate?
The canonical SMILES for 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate is C#CCOC(=O)/C=C/C(=O)OCC(C)OC(=O)CCC(=O)OCC(C)O.
What is the InChIKey of 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate?
The InChIKey is IGJNFCWTAXZZKT-AATRIKPKSA-N. The full InChI is InChI=1S/C17H22O9/c1-4-9-23-14(19)5-6-16(21)25-11-13(3)26-17(22)8-7-15(20)24-10-12(2)18/h1,5-6,12-13,18H,7-11H2,2-3H3/b6-5+.
What are the key properties of 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate?
1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate has a molecular weight of 370.35 g/mol, XLogP of -0.10, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-hydroxypropyl) 4-O-[1-[(E)-4-oxo-4-prop-2-ynoxybut-2-enoyl]oxypropan-2-yl] butanedioate is sourced from PubChem (CID 171580769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).