C26H32N2O9 — CID 123961562
[(4S,4aR,5S,5aR,6R,12aS)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] butanoate (PubChem CID 123961562) has the molecular formula C26H32N2O9 and a molecular weight of 516.55 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aS)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] butanoate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aS)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] butanoate |
|---|---|
| PubChem CID | 123961562 |
| Molecular Formula | C26H32N2O9 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aS)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1[C@H]2C(C(=O)c3c(O)cccc3[C@@H]2C)C(=O)[C@]2(O)C(=O)C(C(N)O)C(=O)[C@@H](N(C)C)[C@H]12 |
| InChI | InChI=1S/C26H32N2O9/c1-5-7-13(30)37-22-14-10(2)11-8-6-9-12(29)15(11)20(31)16(14)23(33)26(36)18(22)19(28(3)4)21(32)17(24(26)34)25(27)35/h6,8-10,14,16-19,22,25,29,35-36H,5,7,27H2,1-4H3/t10-,14+,16?,17?,18+,19-,22-,25?,26-/m0/s1 |
| InChIKey | MFDUXISOWFFJNS-IRACEILMSA-N |
| XLogP | -0.46 |
| TPSA | 184.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|