C31H38N6O5SSi — CID 123965694
N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]-2-nitrobenzenesulfonamide (PubChem CID 123965694) has the molecular formula C31H38N6O5SSi and a molecular weight of 634.84 g/mol. Its IUPAC name is N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 123965694 |
| Molecular Formula | C31H38N6O5SSi |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]-2-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(Nc2cc(-c3ccc(NCCNS(=O)(=O)c4ccccc4[N+](=O)[O-])nc3)ccn2)c1 |
| InChI | InChI=1S/C31H38N6O5SSi/c1-31(2,3)44(4,5)42-22-23-9-8-10-26(19-23)36-30-20-24(15-16-32-30)25-13-14-29(34-21-25)33-17-18-35-43(40,41)28-12-7-6-11-27(28)37(38)39/h6-16,19-21,35H,17-18,22H2,1-5H3,(H,32,36)(H,33,34) |
| InChIKey | GWOGRJBGKVSJIV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|