C18H30N2Si — CID 123969876
butan-2-yl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)-di(propan-2-yl)silane (PubChem CID 123969876) has the molecular formula C18H30N2Si and a molecular weight of 302.54 g/mol. Its IUPAC name is butan-2-yl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)-di(propan-2-yl)silane.
| Compound Name | butan-2-yl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 123969876 |
| Molecular Formula | C18H30N2Si |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | butan-2-yl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)-di(propan-2-yl)silane |
| SMILES | CCC(C)[Si](C(C)C)(C(C)C)n1ccc2cc(C)cnc21 |
| InChI | InChI=1S/C18H30N2Si/c1-8-16(7)21(13(2)3,14(4)5)20-10-9-17-11-15(6)12-19-18(17)20/h9-14,16H,8H2,1-7H3 |
| InChIKey | YNHCKNNTWPFSAL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|