C18H28N2O2Si — CID 66679244
methyl 1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 66679244) has the molecular formula C18H28N2O2Si and a molecular weight of 332.52 g/mol. Its IUPAC name is methyl 1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | methyl 1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 66679244 |
| Molecular Formula | C18H28N2O2Si |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | methyl 1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(ccn2[Si](C(C)C)(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C18H28N2O2Si/c1-12(2)23(13(3)4,14(5)6)20-9-8-15-10-16(18(21)22-7)11-19-17(15)20/h8-14H,1-7H3 |
| InChIKey | QLKNCJFLEHQUMG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|