C16H15ClN2O4S — CID 86706482
methyl 1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)sulfonylpyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 86706482) has the molecular formula C16H15ClN2O4S and a molecular weight of 366.83 g/mol. Its IUPAC name is methyl 1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)sulfonylpyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | methyl 1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)sulfonylpyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 86706482 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | methyl 1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)sulfonylpyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(ccn2S(=O)(=O)C2=CCC(C)(Cl)C=C2)c1 |
| InChI | InChI=1S/C16H15ClN2O4S/c1-16(17)6-3-13(4-7-16)24(21,22)19-8-5-11-9-12(15(20)23-2)10-18-14(11)19/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | TXJXYFUNUAKWQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|