C17H25F3N2Si — CID 46318196
tri(propan-2-yl)-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]silane (PubChem CID 46318196) has the molecular formula C17H25F3N2Si and a molecular weight of 342.48 g/mol. Its IUPAC name is tri(propan-2-yl)-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]silane.
| Compound Name | tri(propan-2-yl)-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]silane |
|---|---|
| PubChem CID | 46318196 |
| Molecular Formula | C17H25F3N2Si |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | tri(propan-2-yl)-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2cc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C17H25F3N2Si/c1-11(2)23(12(3)4,13(5)6)22-8-7-14-9-15(17(18,19)20)10-21-16(14)22/h7-13H,1-6H3 |
| InChIKey | GESOHXDEZSURSM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|