About propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine
propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine (PubChem CID 66907795) has the molecular formula C17H16F3N3O2
and a molecular weight of 351.33 g/mol. Its IUPAC name is propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 66907795 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine |
| SMILES | CCC(=O)O.FC(F)(F)c1cnc2c(ccn2Cc2ccncc2)c1 |
| InChI | InChI=1S/C14H10F3N3.C3H6O2/c15-14(16,17)12-7-11-3-6-20(13(11)19-8-12)9-10-1-4-18-5-2-10;1-2-3(4)5/h1-8H,9H2;2H2,1H3,(H,4,5) |
| InChIKey | PSEYZNQVNIIIJB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine (CID 66907795) is propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine is CCC(=O)O.FC(F)(F)c1cnc2c(ccn2Cc2ccncc2)c1.
What is the InChIKey of propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine?
The InChIKey is PSEYZNQVNIIIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3.C3H6O2/c15-14(16,17)12-7-11-3-6-20(13(11)19-8-12)9-10-1-4-18-5-2-10;1-2-3(4)5/h1-8H,9H2;2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine?
propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine has a molecular weight of 351.33 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 66907795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).