C24H22F3N5O — CID 67950779
1-[2-(ethylamino)-5-(trifluoromethyl)phenyl]-3-[1-(pyridin-4-ylmethyl)indol-4-yl]urea (PubChem CID 67950779) has the molecular formula C24H22F3N5O and a molecular weight of 453.47 g/mol. Its IUPAC name is 1-[2-(ethylamino)-5-(trifluoromethyl)phenyl]-3-[1-(pyridin-4-ylmethyl)indol-4-yl]urea.
| Compound Name | 1-[2-(ethylamino)-5-(trifluoromethyl)phenyl]-3-[1-(pyridin-4-ylmethyl)indol-4-yl]urea |
|---|---|
| PubChem CID | 67950779 |
| Molecular Formula | C24H22F3N5O |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-[2-(ethylamino)-5-(trifluoromethyl)phenyl]-3-[1-(pyridin-4-ylmethyl)indol-4-yl]urea |
| SMILES | CCNc1ccc(C(F)(F)F)cc1NC(=O)Nc1cccc2c1ccn2Cc1ccncc1 |
| InChI | InChI=1S/C24H22F3N5O/c1-2-29-20-7-6-17(24(25,26)27)14-21(20)31-23(33)30-19-4-3-5-22-18(19)10-13-32(22)15-16-8-11-28-12-9-16/h3-14,29H,2,15H2,1H3,(H2,30,31,33) |
| InChIKey | UOCVQOATYJDAIU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |