C22H20ClN5O — CID 58703438
1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(3-chloro-4-methylphenyl)urea (PubChem CID 58703438) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 58703438 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc3c2ccn3Cc2ccnc(N)c2)cc1Cl |
| InChI | InChI=1S/C22H20ClN5O/c1-14-5-6-16(12-18(14)23)26-22(29)27-19-3-2-4-20-17(19)8-10-28(20)13-15-7-9-25-21(24)11-15/h2-12H,13H2,1H3,(H2,24,25)(H2,26,27,29) |
| InChIKey | UKEXULSNZMFFQW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |