C21H18BrN5O — CID 87073652
1-[1-[(2-amino-4-pyridinyl)-dideuteriomethyl]indol-4-yl]-3-(2-bromophenyl)urea (PubChem CID 87073652) has the molecular formula C21H18BrN5O and a molecular weight of 438.33 g/mol. Its IUPAC name is 1-[1-[(2-amino-4-pyridinyl)-dideuteriomethyl]indol-4-yl]-3-(2-bromophenyl)urea.
| Compound Name | 1-[1-[(2-amino-4-pyridinyl)-dideuteriomethyl]indol-4-yl]-3-(2-bromophenyl)urea |
|---|---|
| PubChem CID | 87073652 |
| Molecular Formula | C21H18BrN5O |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 1-[1-[(2-amino-4-pyridinyl)-dideuteriomethyl]indol-4-yl]-3-(2-bromophenyl)urea |
| SMILES | [2H]C([2H])(c1ccnc(N)c1)n1ccc2c(NC(=O)Nc3ccccc3Br)cccc21 |
| InChI | InChI=1S/C21H18BrN5O/c22-16-4-1-2-5-18(16)26-21(28)25-17-6-3-7-19-15(17)9-11-27(19)13-14-8-10-24-20(23)12-14/h1-12H,13H2,(H2,23,24)(H2,25,26,28)/i13D2 |
| InChIKey | RDDBKZUJHZBKFA-KLTYLHELSA-N |
| XLogP | 5.07 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |