C26H29BrN6O3 — CID 143262096
N-[4-[[4-[(5-bromo-2-methoxyphenyl)carbamoylamino]indol-1-yl]methyl]-2-pyridinyl]formamide;propan-2-amine (PubChem CID 143262096) has the molecular formula C26H29BrN6O3 and a molecular weight of 553.46 g/mol. Its IUPAC name is N-[4-[[4-[(5-bromo-2-methoxyphenyl)carbamoylamino]indol-1-yl]methyl]-2-pyridinyl]formamide;propan-2-amine.
| Compound Name | N-[4-[[4-[(5-bromo-2-methoxyphenyl)carbamoylamino]indol-1-yl]methyl]-2-pyridinyl]formamide;propan-2-amine |
|---|---|
| PubChem CID | 143262096 |
| Molecular Formula | C26H29BrN6O3 |
| Molecular Weight | 553.46 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[4-[[4-[(5-bromo-2-methoxyphenyl)carbamoylamino]indol-1-yl]methyl]-2-pyridinyl]formamide;propan-2-amine |
| SMILES | CC(C)N.COc1ccc(Br)cc1NC(=O)Nc1cccc2c1ccn2Cc1ccnc(NC=O)c1 |
| InChI | InChI=1S/C23H20BrN5O3.C3H9N/c1-32-21-6-5-16(24)12-19(21)28-23(31)27-18-3-2-4-20-17(18)8-10-29(20)13-15-7-9-25-22(11-15)26-14-30;1-3(2)4/h2-12,14H,13H2,1H3,(H,25,26,30)(H2,27,28,31);3H,4H2,1-2H3 |
| InChIKey | FWKOMVKKGBBEKK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|