C22H21ClN6O — CID 70640486
1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-[5-chloro-2-(methylamino)phenyl]urea (PubChem CID 70640486) has the molecular formula C22H21ClN6O and a molecular weight of 420.90 g/mol. Its IUPAC name is 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-[5-chloro-2-(methylamino)phenyl]urea.
| Compound Name | 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-[5-chloro-2-(methylamino)phenyl]urea |
|---|---|
| PubChem CID | 70640486 |
| Molecular Formula | C22H21ClN6O |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-[5-chloro-2-(methylamino)phenyl]urea |
| SMILES | CNc1ccc(Cl)cc1NC(=O)Nc1cccc2c1ccn2Cc1ccnc(N)c1 |
| InChI | InChI=1S/C22H21ClN6O/c1-25-18-6-5-15(23)12-19(18)28-22(30)27-17-3-2-4-20-16(17)8-10-29(20)13-14-7-9-26-21(24)11-14/h2-12,25H,13H2,1H3,(H2,24,26)(H2,27,28,30) |
| InChIKey | WFZXTOASMGCQCW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |