C26H27N5O3 — CID 58703446
tert-butyl N-[4-[[4-(phenylcarbamoylamino)indol-1-yl]methyl]-2-pyridinyl]carbamate (PubChem CID 58703446) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(phenylcarbamoylamino)indol-1-yl]methyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(phenylcarbamoylamino)indol-1-yl]methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 58703446 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | tert-butyl N-[4-[[4-(phenylcarbamoylamino)indol-1-yl]methyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cn2ccc3c(NC(=O)Nc4ccccc4)cccc32)ccn1 |
| InChI | InChI=1S/C26H27N5O3/c1-26(2,3)34-25(33)30-23-16-18(12-14-27-23)17-31-15-13-20-21(10-7-11-22(20)31)29-24(32)28-19-8-5-4-6-9-19/h4-16H,17H2,1-3H3,(H,27,30,33)(H2,28,29,32) |
| InChIKey | GNHHAZQFCXQYAT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |