C15H24ClN3Si — CID 58010187
(2-chloropyrrolo[2,3-b]pyrazin-5-yl)-tri(propan-2-yl)silane (PubChem CID 58010187) has the molecular formula C15H24ClN3Si and a molecular weight of 309.92 g/mol. Its IUPAC name is (2-chloropyrrolo[2,3-b]pyrazin-5-yl)-tri(propan-2-yl)silane.
| Compound Name | (2-chloropyrrolo[2,3-b]pyrazin-5-yl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 58010187 |
| Molecular Formula | C15H24ClN3Si |
| Molecular Weight | 309.92 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2-chloropyrrolo[2,3-b]pyrazin-5-yl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2nc(Cl)cnc21 |
| InChI | InChI=1S/C15H24ClN3Si/c1-10(2)20(11(3)4,12(5)6)19-8-7-13-15(19)17-9-14(16)18-13/h7-12H,1-6H3 |
| InChIKey | WZNKWQCEGALXNG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|