C22H29ClN4Si — CID 140891403
[4-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyrrolo[2,3-b]pyridin-1-yl]-tri(propan-2-yl)silane (PubChem CID 140891403) has the molecular formula C22H29ClN4Si and a molecular weight of 413.04 g/mol. Its IUPAC name is [4-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyrrolo[2,3-b]pyridin-1-yl]-tri(propan-2-yl)silane.
| Compound Name | [4-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyrrolo[2,3-b]pyridin-1-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140891403 |
| Molecular Formula | C22H29ClN4Si |
| Molecular Weight | 413.04 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [4-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]pyrrolo[2,3-b]pyridin-1-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(Cl)c(C#Cc3cnn(C)c3)cnc21 |
| InChI | InChI=1S/C22H29ClN4Si/c1-15(2)28(16(3)4,17(5)6)27-11-10-20-21(23)19(13-24-22(20)27)9-8-18-12-25-26(7)14-18/h10-17H,1-7H3 |
| InChIKey | RBOXBGHDQYGWIE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.04 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|