C11H12N2 — CID 146616786
1-methyl-4-(5-methylhexa-1,3-diynyl)pyrazole (PubChem CID 146616786) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-methyl-4-(5-methylhexa-1,3-diynyl)pyrazole.
| Compound Name | 1-methyl-4-(5-methylhexa-1,3-diynyl)pyrazole |
|---|---|
| PubChem CID | 146616786 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-methyl-4-(5-methylhexa-1,3-diynyl)pyrazole |
| SMILES | CC(C)C#CC#Cc1cnn(C)c1 |
| InChI | InChI=1S/C11H12N2/c1-10(2)6-4-5-7-11-8-12-13(3)9-11/h8-10H,1-3H3 |
| InChIKey | SNZFCIKQBHXXNC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|