C12H10N6 — CID 118532362
6-[2-(1-methylpyrazol-4-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 118532362) has the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-[2-(1-methylpyrazol-4-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-[2-(1-methylpyrazol-4-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118532362 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 6-[2-(1-methylpyrazol-4-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1cc(C#Cc2cc3c(N)ncnc3[nH]2)cn1 |
| InChI | InChI=1S/C12H10N6/c1-18-6-8(5-16-18)2-3-9-4-10-11(13)14-7-15-12(10)17-9/h4-7H,1H3,(H3,13,14,15,17) |
| InChIKey | ZYYJAWVBYKVJLC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|