C16H10N4O2 — CID 144964216
N-[6-[2-(1,3-benzodioxol-5-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine (PubChem CID 144964216) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[6-[2-(1,3-benzodioxol-5-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine.
| Compound Name | N-[6-[2-(1,3-benzodioxol-5-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine |
|---|---|
| PubChem CID | 144964216 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[6-[2-(1,3-benzodioxol-5-yl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine |
| SMILES | C=Nc1ncnc2[nH]c(C#Cc3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C16H10N4O2/c1-17-15-12-7-11(20-16(12)19-8-18-15)4-2-10-3-5-13-14(6-10)22-9-21-13/h3,5-8H,1,9H2,(H,18,19,20) |
| InChIKey | NSMBSQACRNPLBJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|