C16H23Cl2FN2Si — CID 156715411
(5,6-dichloro-4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (PubChem CID 156715411) has the molecular formula C16H23Cl2FN2Si and a molecular weight of 361.36 g/mol. Its IUPAC name is (5,6-dichloro-4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane.
| Compound Name | (5,6-dichloro-4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 156715411 |
| Molecular Formula | C16H23Cl2FN2Si |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (5,6-dichloro-4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(F)c(Cl)c(Cl)nc21 |
| InChI | InChI=1S/C16H23Cl2FN2Si/c1-9(2)22(10(3)4,11(5)6)21-8-7-12-14(19)13(17)15(18)20-16(12)21/h7-11H,1-6H3 |
| InChIKey | FPHRROXJGYXBHM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|