C23H20F2 — CID 123971474
1,3-difluoro-5-methyl-2-[1-[4-(4-methylphenyl)phenyl]prop-1-en-2-yl]benzene (PubChem CID 123971474) has the molecular formula C23H20F2 and a molecular weight of 334.41 g/mol. Its IUPAC name is 1,3-difluoro-5-methyl-2-[1-[4-(4-methylphenyl)phenyl]prop-1-en-2-yl]benzene.
| Compound Name | 1,3-difluoro-5-methyl-2-[1-[4-(4-methylphenyl)phenyl]prop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 123971474 |
| Molecular Formula | C23H20F2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1,3-difluoro-5-methyl-2-[1-[4-(4-methylphenyl)phenyl]prop-1-en-2-yl]benzene |
| SMILES | CC(=Cc1ccc(-c2ccc(C)cc2)cc1)c1c(F)cc(C)cc1F |
| InChI | InChI=1S/C23H20F2/c1-15-4-8-19(9-5-15)20-10-6-18(7-11-20)14-17(3)23-21(24)12-16(2)13-22(23)25/h4-14H,1-3H3 |
| InChIKey | RNDZBEDQXLFCQZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|