C22H31N3O11 — CID 123973294
ethyl 5-ethyl-1-[4,5,6-triacetyloxy-7-(acetyloxymethyl)oxepan-2-yl]triazole-4-carboxylate (PubChem CID 123973294) has the molecular formula C22H31N3O11 and a molecular weight of 513.50 g/mol. Its IUPAC name is ethyl 5-ethyl-1-[4,5,6-triacetyloxy-7-(acetyloxymethyl)oxepan-2-yl]triazole-4-carboxylate.
| Compound Name | ethyl 5-ethyl-1-[4,5,6-triacetyloxy-7-(acetyloxymethyl)oxepan-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 123973294 |
| Molecular Formula | C22H31N3O11 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | ethyl 5-ethyl-1-[4,5,6-triacetyloxy-7-(acetyloxymethyl)oxepan-2-yl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C2CC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)O2)c1CC |
| InChI | InChI=1S/C22H31N3O11/c1-7-15-19(22(30)31-8-2)23-24-25(15)18-9-16(33-12(4)27)20(34-13(5)28)21(35-14(6)29)17(36-18)10-32-11(3)26/h16-18,20-21H,7-10H2,1-6H3 |
| InChIKey | WGCUPFJAIIDIHI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 171.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|