C21H29N3O7 — CID 118485767
ethyl 1-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]-5-(3-ethoxy-3-oxoprop-1-ynyl)triazole-4-carboxylate (PubChem CID 118485767) has the molecular formula C21H29N3O7 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl 1-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]-5-(3-ethoxy-3-oxoprop-1-ynyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]-5-(3-ethoxy-3-oxoprop-1-ynyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 118485767 |
| Molecular Formula | C21H29N3O7 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | ethyl 1-[6-(acetyloxymethyl)-3,4,5-trimethyloxan-2-yl]-5-(3-ethoxy-3-oxoprop-1-ynyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)C#Cc1c(C(=O)OCC)nnn1C1OC(COC(C)=O)C(C)C(C)C1C |
| InChI | InChI=1S/C21H29N3O7/c1-7-28-18(26)10-9-16-19(21(27)29-8-2)22-23-24(16)20-14(5)12(3)13(4)17(31-20)11-30-15(6)25/h12-14,17,20H,7-8,11H2,1-6H3 |
| InChIKey | WWRZIGYRVFJKGP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|