C18H24N4O5 — CID 101377698
[(1R,3S,4S)-3-acetyloxy-4-(4-carbamoyl-5-pent-1-ynyltriazol-1-yl)cyclopentyl]methyl acetate (PubChem CID 101377698) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is [(1R,3S,4S)-3-acetyloxy-4-(4-carbamoyl-5-pent-1-ynyltriazol-1-yl)cyclopentyl]methyl acetate.
| Compound Name | [(1R,3S,4S)-3-acetyloxy-4-(4-carbamoyl-5-pent-1-ynyltriazol-1-yl)cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 101377698 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(1R,3S,4S)-3-acetyloxy-4-(4-carbamoyl-5-pent-1-ynyltriazol-1-yl)cyclopentyl]methyl acetate |
| SMILES | CCCC#Cc1c(C(N)=O)nnn1[C@H]1C[C@@H](COC(C)=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H24N4O5/c1-4-5-6-7-14-17(18(19)25)20-21-22(14)15-8-13(10-26-11(2)23)9-16(15)27-12(3)24/h13,15-16H,4-5,8-10H2,1-3H3,(H2,19,25)/t13-,15+,16+/m1/s1 |
| InChIKey | BHYRHQIOWSCYIF-KBMXLJTQSA-N |
| XLogP | 0.97 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|