C44H44ClNO3S — CID 123973407
4-(4-chlorophenyl)sulfanyl-1-[4-methyl-3-[5-(2-methylbenzoyl)-2-(3-methylpentan-2-yl)phenyl]phenyl]-2-phenylmethoxyiminobutan-1-one (PubChem CID 123973407) has the molecular formula C44H44ClNO3S and a molecular weight of 702.36 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-[4-methyl-3-[5-(2-methylbenzoyl)-2-(3-methylpentan-2-yl)phenyl]phenyl]-2-phenylmethoxyiminobutan-1-one.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-[4-methyl-3-[5-(2-methylbenzoyl)-2-(3-methylpentan-2-yl)phenyl]phenyl]-2-phenylmethoxyiminobutan-1-one |
|---|---|
| PubChem CID | 123973407 |
| Molecular Formula | C44H44ClNO3S |
| Molecular Weight | 702.36 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-[4-methyl-3-[5-(2-methylbenzoyl)-2-(3-methylpentan-2-yl)phenyl]phenyl]-2-phenylmethoxyiminobutan-1-one |
| SMILES | CCC(C)C(C)c1ccc(C(=O)c2ccccc2C)cc1-c1cc(C(=O)C(CCSc2ccc(Cl)cc2)=NOCc2ccccc2)ccc1C |
| InChI | InChI=1S/C44H44ClNO3S/c1-6-29(2)32(5)39-23-18-34(43(47)38-15-11-10-12-30(38)3)27-41(39)40-26-35(17-16-31(40)4)44(48)42(46-49-28-33-13-8-7-9-14-33)24-25-50-37-21-19-36(45)20-22-37/h7-23,26-27,29,32H,6,24-25,28H2,1-5H3 |
| InChIKey | WHVUNIKAPLLPNP-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.36 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|