C39H35ClN2O4S — CID 144783255
[(E)-[4-(4-chlorophenyl)sulfanyl-1-[4-[N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(2-methylbenzoyl)anilino]phenyl]-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 144783255) has the molecular formula C39H35ClN2O4S and a molecular weight of 663.24 g/mol. Its IUPAC name is [(E)-[4-(4-chlorophenyl)sulfanyl-1-[4-[N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(2-methylbenzoyl)anilino]phenyl]-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[4-[N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(2-methylbenzoyl)anilino]phenyl]-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 144783255 |
| Molecular Formula | C39H35ClN2O4S |
| Molecular Weight | 663.24 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[4-[N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(2-methylbenzoyl)anilino]phenyl]-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | C=C/C(=C\C=C/C)N(c1ccc(C(=O)/C(CCSc2ccc(Cl)cc2)=N/OC(C)=O)cc1)c1ccc(C(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C39H35ClN2O4S/c1-5-7-11-32(6-2)42(33-19-13-29(14-20-33)38(44)36-12-9-8-10-27(36)3)34-21-15-30(16-22-34)39(45)37(41-46-28(4)43)25-26-47-35-23-17-31(40)18-24-35/h5-24H,2,25-26H2,1,3-4H3/b7-5-,32-11+,41-37+ |
| InChIKey | ADLIIEWFXDIGCY-BLSDEALOSA-N |
| XLogP | 9.95 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.24 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|