C38H33ClN2O4S — CID 144619203
acetic acid;4-(4-chlorophenyl)sulfanyl-2-imino-1-[4-(N-[4-(2-methylbenzoyl)phenyl]anilino)phenyl]butan-1-one (PubChem CID 144619203) has the molecular formula C38H33ClN2O4S and a molecular weight of 649.21 g/mol. Its IUPAC name is acetic acid;4-(4-chlorophenyl)sulfanyl-2-imino-1-[4-(N-[4-(2-methylbenzoyl)phenyl]anilino)phenyl]butan-1-one.
| Compound Name | acetic acid;4-(4-chlorophenyl)sulfanyl-2-imino-1-[4-(N-[4-(2-methylbenzoyl)phenyl]anilino)phenyl]butan-1-one |
|---|---|
| PubChem CID | 144619203 |
| Molecular Formula | C38H33ClN2O4S |
| Molecular Weight | 649.21 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | acetic acid;4-(4-chlorophenyl)sulfanyl-2-imino-1-[4-(N-[4-(2-methylbenzoyl)phenyl]anilino)phenyl]butan-1-one |
| SMILES | CC(=O)O.[H]/N=C(\CCSc1ccc(Cl)cc1)C(=O)c1ccc(N(c2ccccc2)c2ccc(C(=O)c3ccccc3C)cc2)cc1 |
| InChI | InChI=1S/C36H29ClN2O2S.C2H4O2/c1-25-7-5-6-10-33(25)35(40)26-11-17-30(18-12-26)39(29-8-3-2-4-9-29)31-19-13-27(14-20-31)36(41)34(38)23-24-42-32-21-15-28(37)16-22-32;1-2(3)4/h2-22,38H,23-24H2,1H3;1H3,(H,3,4)/b38-34+; |
| InChIKey | QGOWBHLRFZFRNM-XPVOFEIOSA-N |
| XLogP | 9.82 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.21 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|