C36H32Cl2N2O6S3 — CID 172945447
[(E)-[1-[4-[4-[(2E)-2-acetyloxyimino-4-(4-chlorophenyl)sulfanylbutanoyl]phenyl]sulfanylcyclohexa-1,3-dien-1-yl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 172945447) has the molecular formula C36H32Cl2N2O6S3 and a molecular weight of 755.77 g/mol. Its IUPAC name is [(E)-[1-[4-[4-[(2E)-2-acetyloxyimino-4-(4-chlorophenyl)sulfanylbutanoyl]phenyl]sulfanylcyclohexa-1,3-dien-1-yl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[4-[4-[(2E)-2-acetyloxyimino-4-(4-chlorophenyl)sulfanylbutanoyl]phenyl]sulfanylcyclohexa-1,3-dien-1-yl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 172945447 |
| Molecular Formula | C36H32Cl2N2O6S3 |
| Molecular Weight | 755.77 g/mol |
| Exact Mass | 754.08 |
| IUPAC Name | [(E)-[1-[4-[4-[(2E)-2-acetyloxyimino-4-(4-chlorophenyl)sulfanylbutanoyl]phenyl]sulfanylcyclohexa-1,3-dien-1-yl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\CCSc1ccc(Cl)cc1)C(=O)C1=CC=C(Sc2ccc(C(=O)/C(CCSc3ccc(Cl)cc3)=N/OC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C36H32Cl2N2O6S3/c1-23(41)45-39-33(19-21-47-29-15-7-27(37)8-16-29)35(43)25-3-11-31(12-4-25)49-32-13-5-26(6-14-32)36(44)34(40-46-24(2)42)20-22-48-30-17-9-28(38)10-18-30/h3-5,7-13,15-18H,6,14,19-22H2,1-2H3/b39-33+,40-34+ |
| InChIKey | ZBBNUXPXGDBHQU-CFTRLRGZSA-N |
| XLogP | 9.64 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.77 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|