C41H39IN2O3S — CID 89134492
(2E)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]imino-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4-[4-(iodomethyl)phenyl]sulfanylbutan-1-one (PubChem CID 89134492) has the molecular formula C41H39IN2O3S and a molecular weight of 766.75 g/mol. Its IUPAC name is (2E)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]imino-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4-[4-(iodomethyl)phenyl]sulfanylbutan-1-one.
| Compound Name | (2E)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]imino-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4-[4-(iodomethyl)phenyl]sulfanylbutan-1-one |
|---|---|
| PubChem CID | 89134492 |
| Molecular Formula | C41H39IN2O3S |
| Molecular Weight | 766.75 g/mol |
| Exact Mass | 766.17 |
| IUPAC Name | (2E)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]imino-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4-[4-(iodomethyl)phenyl]sulfanylbutan-1-one |
| SMILES | C=C/C=C\C(=C/C)CO/N=C(\CCSc1ccc(CI)cc1)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C41H39IN2O3S/c1-5-8-12-29(6-2)27-47-43-37(22-23-48-33-18-14-30(26-42)15-19-33)41(46)32-17-21-39-36(25-32)35-24-31(16-20-38(35)44(39)7-3)40(45)34-13-10-9-11-28(34)4/h5-6,8-21,24-25H,1,7,22-23,26-27H2,2-4H3/b12-8-,29-6+,43-37+ |
| InChIKey | SNIZWMXXLVHUBK-MEQKHZCJSA-N |
| XLogP | 10.72 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.75 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|