C19H17N3O2S — CID 123976011
2-(2-methylphenyl)-3H-indole-7-carboxylic acid;1,3-thiazol-2-amine (PubChem CID 123976011) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(2-methylphenyl)-3H-indole-7-carboxylic acid;1,3-thiazol-2-amine.
| Compound Name | 2-(2-methylphenyl)-3H-indole-7-carboxylic acid;1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123976011 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(2-methylphenyl)-3H-indole-7-carboxylic acid;1,3-thiazol-2-amine |
| SMILES | Cc1ccccc1C1=Nc2c(cccc2C(=O)O)C1.Nc1nccs1 |
| InChI | InChI=1S/C16H13NO2.C3H4N2S/c1-10-5-2-3-7-12(10)14-9-11-6-4-8-13(16(18)19)15(11)17-14;4-3-5-1-2-6-3/h2-8H,9H2,1H3,(H,18,19);1-2H,(H2,4,5) |
| InChIKey | FSBJIHYMUZAUEA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |