C22H16ClN5O3S — CID 123978727
1-chloro-4-isocyano-N-[(4-methoxyphenyl)methyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide (PubChem CID 123978727) has the molecular formula C22H16ClN5O3S and a molecular weight of 465.92 g/mol. Its IUPAC name is 1-chloro-4-isocyano-N-[(4-methoxyphenyl)methyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide.
| Compound Name | 1-chloro-4-isocyano-N-[(4-methoxyphenyl)methyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 123978727 |
| Molecular Formula | C22H16ClN5O3S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 1-chloro-4-isocyano-N-[(4-methoxyphenyl)methyl]-N-pyrimidin-4-ylisoquinoline-6-sulfonamide |
| SMILES | [C-]#[N+]c1cnc(Cl)c2ccc(S(=O)(=O)N(Cc3ccc(OC)cc3)c3ccncn3)cc12 |
| InChI | InChI=1S/C22H16ClN5O3S/c1-24-20-12-26-22(23)18-8-7-17(11-19(18)20)32(29,30)28(21-9-10-25-14-27-21)13-15-3-5-16(31-2)6-4-15/h3-12,14H,13H2,2H3 |
| InChIKey | DPRSRVAEQUOLEM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|