C20H19ClO4 — CID 123979465
ethyl 3-[5-chloro-2-[hydroxy(phenyl)methyl]-1-benzofuran-3-yl]propanoate (PubChem CID 123979465) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is ethyl 3-[5-chloro-2-[hydroxy(phenyl)methyl]-1-benzofuran-3-yl]propanoate.
| Compound Name | ethyl 3-[5-chloro-2-[hydroxy(phenyl)methyl]-1-benzofuran-3-yl]propanoate |
|---|---|
| PubChem CID | 123979465 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | ethyl 3-[5-chloro-2-[hydroxy(phenyl)methyl]-1-benzofuran-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(C(O)c2ccccc2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H19ClO4/c1-2-24-18(22)11-9-15-16-12-14(21)8-10-17(16)25-20(15)19(23)13-6-4-3-5-7-13/h3-8,10,12,19,23H,2,9,11H2,1H3 |
| InChIKey | UGCJCMZEEFHAQQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |