C22H30N2O5 — CID 123980670
3-cyclopentyloxy-N-[3-[[cyclopropyl(hydroxy)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide (PubChem CID 123980670) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-[3-[[cyclopropyl(hydroxy)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide.
| Compound Name | 3-cyclopentyloxy-N-[3-[[cyclopropyl(hydroxy)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide |
|---|---|
| PubChem CID | 123980670 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-cyclopentyloxy-N-[3-[[cyclopropyl(hydroxy)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide |
| SMILES | O=C(NC1COC2C(NC(O)C3CC3)COC12)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C22H30N2O5/c25-21(13-8-9-13)23-17-11-27-20-18(12-28-19(17)20)24-22(26)14-4-3-7-16(10-14)29-15-5-1-2-6-15/h3-4,7,10,13,15,17-21,23,25H,1-2,5-6,8-9,11-12H2,(H,24,26) |
| InChIKey | WYLPXOPFDBXPKD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|