C22H23N3O5 — CID 70968785
N-[(3S)-3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-pyridin-3-yloxybenzamide (PubChem CID 70968785) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[(3S)-3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-pyridin-3-yloxybenzamide.
| Compound Name | N-[(3S)-3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-pyridin-3-yloxybenzamide |
|---|---|
| PubChem CID | 70968785 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[(3S)-3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-pyridin-3-yloxybenzamide |
| SMILES | O=C(NC1COC2C1OC[C@@H]2NC(=O)C1CC1)c1cccc(Oc2cccnc2)c1 |
| InChI | InChI=1S/C22H23N3O5/c26-21(13-6-7-13)24-17-11-28-20-18(12-29-19(17)20)25-22(27)14-3-1-4-15(9-14)30-16-5-2-8-23-10-16/h1-5,8-10,13,17-20H,6-7,11-12H2,(H,24,26)(H,25,27)/t17-,18?,19?,20?/m0/s1 |
| InChIKey | CKMOHWXELKSFMI-FKUUAESASA-N |
| XLogP | 1.66 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |