C25H27NO6 — CID 159364300
N-[(3S,3aR,6S,6aR)-3-[2-[3-(2-methoxyphenoxy)phenyl]-2-oxoethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide (PubChem CID 159364300) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-[2-[3-(2-methoxyphenoxy)phenyl]-2-oxoethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-[2-[3-(2-methoxyphenoxy)phenyl]-2-oxoethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 159364300 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-[2-[3-(2-methoxyphenoxy)phenyl]-2-oxoethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
| SMILES | COc1ccccc1Oc1cccc(C(=O)C[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C25H27NO6/c1-29-21-7-2-3-8-22(21)32-18-6-4-5-16(11-18)20(27)12-17-13-30-24-19(14-31-23(17)24)26-25(28)15-9-10-15/h2-8,11,15,17,19,23-24H,9-10,12-14H2,1H3,(H,26,28)/t17-,19-,23+,24+/m0/s1 |
| InChIKey | LIXWCDJKZXFCKD-BLCURXPKSA-N |
| XLogP | 3.37 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |