C22H23NO5 — CID 159028558
N-[(3S,3aR,6S,6aR)-3-[2-oxo-2-(3-phenoxyphenyl)ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide (PubChem CID 159028558) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-[2-oxo-2-(3-phenoxyphenyl)ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-[2-oxo-2-(3-phenoxyphenyl)ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide |
|---|---|
| PubChem CID | 159028558 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-[2-oxo-2-(3-phenoxyphenyl)ethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CO[C@@H]2[C@@H](CC(=O)c3cccc(Oc4ccccc4)c3)CO[C@@H]21 |
| InChI | InChI=1S/C22H23NO5/c1-14(24)23-19-13-27-21-16(12-26-22(19)21)11-20(25)15-6-5-9-18(10-15)28-17-7-3-2-4-8-17/h2-10,16,19,21-22H,11-13H2,1H3,(H,23,24)/t16-,19-,21+,22+/m0/s1 |
| InChIKey | JUOVSORISDEDDV-NTSGDEEZSA-N |
| XLogP | 2.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |