C23H26N2O5 — CID 163547316
N-[3-[[hydroxy-(4-phenoxyphenyl)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide (PubChem CID 163547316) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[3-[[hydroxy-(4-phenoxyphenyl)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[hydroxy-(4-phenoxyphenyl)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 163547316 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[3-[[hydroxy-(4-phenoxyphenyl)methyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
| SMILES | O=C(NC1COC2C(NC(O)c3ccc(Oc4ccccc4)cc3)COC12)C1CC1 |
| InChI | InChI=1S/C23H26N2O5/c26-22(14-6-7-14)24-18-12-28-21-19(13-29-20(18)21)25-23(27)15-8-10-17(11-9-15)30-16-4-2-1-3-5-16/h1-5,8-11,14,18-21,23,25,27H,6-7,12-13H2,(H,24,26) |
| InChIKey | FGDXUECKQKSDHK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|