C22H24N2O4S — CID 70968844
N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-(thiophen-2-ylmethyl)benzamide (PubChem CID 70968844) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 70968844 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NC1COC2C(NC(=O)C3CC3)COC12)c1ccccc1Cc1cccs1 |
| InChI | InChI=1S/C22H24N2O4S/c25-21(13-7-8-13)23-17-11-27-20-18(12-28-19(17)20)24-22(26)16-6-2-1-4-14(16)10-15-5-3-9-29-15/h1-6,9,13,17-20H,7-8,10-12H2,(H,23,25)(H,24,26) |
| InChIKey | RBTWBSMRADQLOG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |