C23H25N3O4 — CID 70968802
2-anilino-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide (PubChem CID 70968802) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-anilino-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide.
| Compound Name | 2-anilino-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide |
|---|---|
| PubChem CID | 70968802 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-anilino-N-[3-(cyclopropanecarbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]benzamide |
| SMILES | O=C(NC1COC2C(NC(=O)C3CC3)COC12)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C23H25N3O4/c27-22(14-10-11-14)25-18-12-29-21-19(13-30-20(18)21)26-23(28)16-8-4-5-9-17(16)24-15-6-2-1-3-7-15/h1-9,14,18-21,24H,10-13H2,(H,25,27)(H,26,28) |
| InChIKey | VQTDJTJQMBVZPQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |