C10H15N — CID 123981084
4-propan-2-ylcyclohepta-2,4-dien-1-imine (PubChem CID 123981084) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 4-propan-2-ylcyclohepta-2,4-dien-1-imine.
| Compound Name | 4-propan-2-ylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123981084 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4-propan-2-ylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(C(C)C)=CCC1 |
| InChI | InChI=1S/C10H15N/c1-8(2)9-4-3-5-10(11)7-6-9/h4,6-8,11H,3,5H2,1-2H3/b11-10+ |
| InChIKey | WNIUKJAGLGMWEG-ZHACJKMWSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|