C22H24F2O2 — CID 123982420
5-[(4,6-difluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)cyclopentan-1-one (PubChem CID 123982420) has the molecular formula C22H24F2O2 and a molecular weight of 358.43 g/mol. Its IUPAC name is 5-[(4,6-difluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)cyclopentan-1-one.
| Compound Name | 5-[(4,6-difluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 123982420 |
| Molecular Formula | C22H24F2O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 5-[(4,6-difluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)cyclopentan-1-one |
| SMILES | Cc1cc(C)c(C2C(=O)C(CC3=CCC(F)=CC(F)=C3)CC2O)c(C)c1 |
| InChI | InChI=1S/C22H24F2O2/c1-12-6-13(2)20(14(3)7-12)21-19(25)10-16(22(21)26)8-15-4-5-17(23)11-18(24)9-15/h4,6-7,9,11,16,19,21,25H,5,8,10H2,1-3H3 |
| InChIKey | PKXWHCHEUJPQRG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |