C18H28O3 — CID 123982440
2-[(2-methylpropan-2-yl)oxy]-3-prop-1-en-2-ylundeca-3,5,7-trienoic acid (PubChem CID 123982440) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-3-prop-1-en-2-ylundeca-3,5,7-trienoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-3-prop-1-en-2-ylundeca-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 123982440 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-3-prop-1-en-2-ylundeca-3,5,7-trienoic acid |
| SMILES | C=C(C)C(=CC=CC=CCCC)C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H28O3/c1-7-8-9-10-11-12-13-15(14(2)3)16(17(19)20)21-18(4,5)6/h9-13,16H,2,7-8H2,1,3-6H3,(H,19,20) |
| InChIKey | KXGZSIPOOXIKEH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|