C16H16O — CID 1239839
trans-(2S,4S)-2-methyl-4-naphthalen-2-ylcyclopentan-1-one (PubChem CID 1239839) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is trans-(2S,4S)-2-methyl-4-naphthalen-2-ylcyclopentan-1-one.
| Compound Name | trans-(2S,4S)-2-methyl-4-naphthalen-2-ylcyclopentan-1-one |
|---|---|
| PubChem CID | 1239839 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | trans-(2S,4S)-2-methyl-4-naphthalen-2-ylcyclopentan-1-one |
| SMILES | C[C@H]1C[C@H](c2ccc3ccccc3c2)CC1=O |
| InChI | InChI=1S/C16H16O/c1-11-8-15(10-16(11)17)14-7-6-12-4-2-3-5-13(12)9-14/h2-7,9,11,15H,8,10H2,1H3/t11-,15-/m0/s1 |
| InChIKey | POLJERGJUZXYAO-NHYWBVRUSA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |